C22H21F3N2O3 — CID 110589215
3-(3,4-dimethylphenyl)-1-propan-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione (PubChem CID 110589215) has the molecular formula C22H21F3N2O3 and a molecular weight of 418.42 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-1-propan-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethylphenyl)-1-propan-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110589215 |
| Molecular Formula | C22H21F3N2O3 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-1-propan-2-yl-4-[3-(trifluoromethoxy)anilino]pyrrole-2,5-dione |
| SMILES | Cc1ccc(C2=C(Nc3cccc(OC(F)(F)F)c3)C(=O)N(C(C)C)C2=O)cc1C |
| InChI | InChI=1S/C22H21F3N2O3/c1-12(2)27-20(28)18(15-9-8-13(3)14(4)10-15)19(21(27)29)26-16-6-5-7-17(11-16)30-22(23,24)25/h5-12,26H,1-4H3 |
| InChIKey | NMOIFHVCLCMUPW-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|