C27H25ClN2O2 — CID 110589323
1-(3-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-(4-ethylanilino)pyrrole-2,5-dione (PubChem CID 110589323) has the molecular formula C27H25ClN2O2 and a molecular weight of 444.96 g/mol. Its IUPAC name is 1-(3-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-(4-ethylanilino)pyrrole-2,5-dione.
| Compound Name | 1-(3-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-(4-ethylanilino)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110589323 |
| Molecular Formula | C27H25ClN2O2 |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | 1-(3-chloro-2-methylphenyl)-3-(3,4-dimethylphenyl)-4-(4-ethylanilino)pyrrole-2,5-dione |
| SMILES | CCc1ccc(NC2=C(c3ccc(C)c(C)c3)C(=O)N(c3cccc(Cl)c3C)C2=O)cc1 |
| InChI | InChI=1S/C27H25ClN2O2/c1-5-19-10-13-21(14-11-19)29-25-24(20-12-9-16(2)17(3)15-20)26(31)30(27(25)32)23-8-6-7-22(28)18(23)4/h6-15,29H,5H2,1-4H3 |
| InChIKey | CFMDIXSWHJPAON-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|