C29H32OSi — CID 11058978
1-[(2R,3aS,7aS)-2-triphenylsilyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone (PubChem CID 11058978) has the molecular formula C29H32OSi and a molecular weight of 424.66 g/mol. Its IUPAC name is 1-[(2R,3aS,7aS)-2-triphenylsilyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone.
| Compound Name | 1-[(2R,3aS,7aS)-2-triphenylsilyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
|---|---|
| PubChem CID | 11058978 |
| Molecular Formula | C29H32OSi |
| Molecular Weight | 424.66 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[(2R,3aS,7aS)-2-triphenylsilyl-1,2,3,4,5,6,7,7a-octahydroinden-3a-yl]ethanone |
| SMILES | CC(=O)[C@]12CCCC[C@H]1C[C@@H]([Si](c1ccccc1)(c1ccccc1)c1ccccc1)C2 |
| InChI | InChI=1S/C29H32OSi/c1-23(30)29-20-12-11-13-24(29)21-28(22-29)31(25-14-5-2-6-15-25,26-16-7-3-8-17-26)27-18-9-4-10-19-27/h2-10,14-19,24,28H,11-13,20-22H2,1H3/t24-,28+,29+/m0/s1 |
| InChIKey | GPPUKSIPWYTRLJ-TUMTZTIRSA-N |
| XLogP | 5.09 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.66 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|