About (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate
(6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (PubChem CID 11059058) has the molecular formula C21H20ClN3O5
and a molecular weight of 429.86 g/mol. Its IUPAC name is (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| PubChem CID | 11059058 |
| Molecular Formula | C21H20ClN3O5 |
| Molecular Weight | 429.86 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1cc2c(cc1Cl)OCO2)N1CCC(n2c(=O)[nH]c3ccccc32)CC1 |
| InChI | InChI=1S/C21H20ClN3O5/c22-15-10-19-18(29-12-30-19)9-13(15)11-28-21(27)24-7-5-14(6-8-24)25-17-4-2-1-3-16(17)23-20(25)26/h1-4,9-10,14H,5-8,11-12H2,(H,23,26) |
| InChIKey | HLZHNRNWOPIWCL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 85.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate?
The IUPAC name of (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate (CID 11059058) is (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate.
What is the SMILES notation for (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate?
The canonical SMILES for (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate is O=C(OCc1cc2c(cc1Cl)OCO2)N1CCC(n2c(=O)[nH]c3ccccc32)CC1.
What is the InChIKey of (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate?
The InChIKey is HLZHNRNWOPIWCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20ClN3O5/c22-15-10-19-18(29-12-30-19)9-13(15)11-28-21(27)24-7-5-14(6-8-24)25-17-4-2-1-3-16(17)23-20(25)26/h1-4,9-10,14H,5-8,11-12H2,(H,23,26).
What are the key properties of (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate?
(6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate has a molecular weight of 429.86 g/mol, XLogP of 3.69, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (6-chloro-1,3-benzodioxol-5-yl)methyl 4-(2-oxo-3H-benzimidazol-1-yl)piperidine-1-carboxylate is sourced from PubChem (CID 11059058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).