C26H27NO5 — CID 11059122
4,19-dimethoxy-15-methyl-16-phenyl-9-oxa-15-azatetracyclo[9.8.0.02,7.012,17]nonadeca-1(19),2,4,6,11,17-hexaene-5,18-diol (PubChem CID 11059122) has the molecular formula C26H27NO5 and a molecular weight of 433.50 g/mol. Its IUPAC name is 4,19-dimethoxy-15-methyl-16-phenyl-9-oxa-15-azatetracyclo[9.8.0.02,7.012,17]nonadeca-1(19),2,4,6,11,17-hexaene-5,18-diol.
| Compound Name | 4,19-dimethoxy-15-methyl-16-phenyl-9-oxa-15-azatetracyclo[9.8.0.02,7.012,17]nonadeca-1(19),2,4,6,11,17-hexaene-5,18-diol |
|---|---|
| PubChem CID | 11059122 |
| Molecular Formula | C26H27NO5 |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | 4,19-dimethoxy-15-methyl-16-phenyl-9-oxa-15-azatetracyclo[9.8.0.02,7.012,17]nonadeca-1(19),2,4,6,11,17-hexaene-5,18-diol |
| SMILES | COc1cc2c(cc1O)COCc1c3c(c(O)c(OC)c1-2)C(c1ccccc1)N(C)CC3 |
| InChI | InChI=1S/C26H27NO5/c1-27-10-9-17-19-14-32-13-16-11-20(28)21(30-2)12-18(16)22(19)26(31-3)25(29)23(17)24(27)15-7-5-4-6-8-15/h4-8,11-12,24,28-29H,9-10,13-14H2,1-3H3 |
| InChIKey | HBRUKQOOHZJQSZ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|