C25H24N2O4S — CID 110592055
3-(3-ethoxyanilino)-1-(2-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione (PubChem CID 110592055) has the molecular formula C25H24N2O4S and a molecular weight of 448.54 g/mol. Its IUPAC name is 3-(3-ethoxyanilino)-1-(2-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3-ethoxyanilino)-1-(2-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110592055 |
| Molecular Formula | C25H24N2O4S |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-(3-ethoxyanilino)-1-(2-propoxyphenyl)-4-thiophen-2-ylpyrrole-2,5-dione |
| SMILES | CCCOc1ccccc1N1C(=O)C(Nc2cccc(OCC)c2)=C(c2cccs2)C1=O |
| InChI | InChI=1S/C25H24N2O4S/c1-3-14-31-20-12-6-5-11-19(20)27-24(28)22(21-13-8-15-32-21)23(25(27)29)26-17-9-7-10-18(16-17)30-4-2/h5-13,15-16,26H,3-4,14H2,1-2H3 |
| InChIKey | WNSWHFUGIUHGQB-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|