About CID 11059224
CID 11059224 (PubChem CID 11059224) has the molecular formula C20H39RhSi2
and a molecular weight of 438.61 g/mol.
Molecular Properties
| Compound Name | CID 11059224 |
| PubChem CID | 11059224 |
| Molecular Formula | C20H39RhSi2 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | — |
| SMILES | C=C[Si](C)(C)C.C=C[Si](C)(C)C.C[C]1C(C)=C(C)C(C)=C1C.[Rh] |
| InChI | InChI=1S/C10H15.2C5H12Si.Rh/c1-6-7(2)9(4)10(5)8(6)3;2*1-5-6(2,3)4;/h1-5H3;2*5H,1H2,2-4H3; |
| InChIKey | ZDFHYHIDFUPBMB-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 11059224 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11059224?
The IUPAC name of CID 11059224 (CID 11059224) is not available.
What is the SMILES notation for CID 11059224?
The canonical SMILES for CID 11059224 is C=C[Si](C)(C)C.C=C[Si](C)(C)C.C[C]1C(C)=C(C)C(C)=C1C.[Rh].
What is the InChIKey of CID 11059224?
The InChIKey is ZDFHYHIDFUPBMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15.2C5H12Si.Rh/c1-6-7(2)9(4)10(5)8(6)3;2*1-5-6(2,3)4;/h1-5H3;2*5H,1H2,2-4H3;.
What are the key properties of CID 11059224?
CID 11059224 has a molecular weight of 438.61 g/mol, XLogP of 7.36, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11059224 is sourced from PubChem (CID 11059224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).