C22H14ClN3O3S — CID 110592291
4-[3-(3-chloro-4-methoxyanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzonitrile (PubChem CID 110592291) has the molecular formula C22H14ClN3O3S and a molecular weight of 435.89 g/mol. Its IUPAC name is 4-[3-(3-chloro-4-methoxyanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzonitrile.
| Compound Name | 4-[3-(3-chloro-4-methoxyanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 110592291 |
| Molecular Formula | C22H14ClN3O3S |
| Molecular Weight | 435.89 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | 4-[3-(3-chloro-4-methoxyanilino)-2,5-dioxo-4-thiophen-2-ylpyrrol-1-yl]benzonitrile |
| SMILES | COc1ccc(NC2=C(c3cccs3)C(=O)N(c3ccc(C#N)cc3)C2=O)cc1Cl |
| InChI | InChI=1S/C22H14ClN3O3S/c1-29-17-9-6-14(11-16(17)23)25-20-19(18-3-2-10-30-18)21(27)26(22(20)28)15-7-4-13(12-24)5-8-15/h2-11,25H,1H3 |
| InChIKey | CIOBQKCZNXAUSF-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.89 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|