About tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate
tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate (PubChem CID 11059273) has the molecular formula C25H25Cl2NO2
and a molecular weight of 442.39 g/mol. Its IUPAC name is tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate.
Molecular Properties
| Compound Name | tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
| PubChem CID | 11059273 |
| Molecular Formula | C25H25Cl2NO2 |
| Molecular Weight | 442.39 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate |
| SMILES | CC(C)(C)OC(=O)[C@](C)(Cc1ccc(Cl)cc1Cl)/N=C/c1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H25Cl2NO2/c1-24(2,3)30-23(29)25(4,15-20-11-12-21(26)14-22(20)27)28-16-17-9-10-18-7-5-6-8-19(18)13-17/h5-14,16H,15H2,1-4H3/b28-16+/t25-/m0/s1 |
| InChIKey | ZMYHGHDQYPKCKT-SXFMOBQTSA-N |
| XLogP | 6.91 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 442.39 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate?
The IUPAC name of tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate (CID 11059273) is tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate.
What is the SMILES notation for tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate?
The canonical SMILES for tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate is CC(C)(C)OC(=O)[C@](C)(Cc1ccc(Cl)cc1Cl)/N=C/c1ccc2ccccc2c1.
What is the InChIKey of tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate?
The InChIKey is ZMYHGHDQYPKCKT-SXFMOBQTSA-N. The full InChI is InChI=1S/C25H25Cl2NO2/c1-24(2,3)30-23(29)25(4,15-20-11-12-21(26)14-22(20)27)28-16-17-9-10-18-7-5-6-8-19(18)13-17/h5-14,16H,15H2,1-4H3/b28-16+/t25-/m0/s1.
What are the key properties of tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate?
tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate has a molecular weight of 442.39 g/mol, XLogP of 6.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-3-(2,4-dichlorophenyl)-2-methyl-2-(naphthalen-2-ylmethylideneamino)propanoate is sourced from PubChem (CID 11059273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).