C26H24N2O5 — CID 110593009
3-(3-methoxyanilino)-4-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]pyrrole-2,5-dione (PubChem CID 110593009) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is 3-(3-methoxyanilino)-4-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]pyrrole-2,5-dione.
| Compound Name | 3-(3-methoxyanilino)-4-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110593009 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 3-(3-methoxyanilino)-4-(4-methoxyphenyl)-1-[(2-methoxyphenyl)methyl]pyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Nc3cccc(OC)c3)C(=O)N(Cc3ccccc3OC)C2=O)cc1 |
| InChI | InChI=1S/C26H24N2O5/c1-31-20-13-11-17(12-14-20)23-24(27-19-8-6-9-21(15-19)32-2)26(30)28(25(23)29)16-18-7-4-5-10-22(18)33-3/h4-15,27H,16H2,1-3H3 |
| InChIKey | ZRFAAUWXJIJSQI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|