C25H28N6O2 — CID 11059317
16-[2-(dimethylamino)ethyl]-10-(2-pyrrolidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2,4,6,8,11(19),12,14(18)-heptaene-15,17-dione (PubChem CID 11059317) has the molecular formula C25H28N6O2 and a molecular weight of 444.54 g/mol. Its IUPAC name is 16-[2-(dimethylamino)ethyl]-10-(2-pyrrolidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2,4,6,8,11(19),12,14(18)-heptaene-15,17-dione.
| Compound Name | 16-[2-(dimethylamino)ethyl]-10-(2-pyrrolidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2,4,6,8,11(19),12,14(18)-heptaene-15,17-dione |
|---|---|
| PubChem CID | 11059317 |
| Molecular Formula | C25H28N6O2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.23 |
| IUPAC Name | 16-[2-(dimethylamino)ethyl]-10-(2-pyrrolidin-1-ylethyl)-1,9,10,16-tetrazapentacyclo[9.6.2.02,7.08,19.014,18]nonadeca-2,4,6,8,11(19),12,14(18)-heptaene-15,17-dione |
| SMILES | CN(C)CCn1c(=O)c2ccc3c4c(nn3CCN3CCCC3)c3ccccc3n(c1=O)c24 |
| InChI | InChI=1S/C25H28N6O2/c1-27(2)13-15-29-24(32)18-9-10-20-21-22(26-30(20)16-14-28-11-5-6-12-28)17-7-3-4-8-19(17)31(23(18)21)25(29)33/h3-4,7-10H,5-6,11-16H2,1-2H3 |
| InChIKey | ILFZVLNGAYCIMZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|