C13H21ClHgO2 — CID 11059332
[3-(2-acetyloxyethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]-chloromercury (PubChem CID 11059332) has the molecular formula C13H21ClHgO2 and a molecular weight of 445.35 g/mol. Its IUPAC name is [3-(2-acetyloxyethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]-chloromercury.
| Compound Name | [3-(2-acetyloxyethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]-chloromercury |
|---|---|
| PubChem CID | 11059332 |
| Molecular Formula | C13H21ClHgO2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [3-(2-acetyloxyethyl)-2,2,4-trimethylcyclohex-3-en-1-yl]-chloromercury |
| SMILES | CC(=O)OCCC1=C(C)CCC([Hg]Cl)C1(C)C |
| InChI | InChI=1S/C13H21O2.ClH.Hg/c1-10-6-5-8-13(3,4)12(10)7-9-15-11(2)14;;/h8H,5-7,9H2,1-4H3;1H;/q;;+1/p-1 |
| InChIKey | IEXWEOLXNSETAB-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|