C24H20N2O2 — CID 110594191
3-anilino-4-phenyl-1-(2-phenylethyl)pyrrole-2,5-dione (PubChem CID 110594191) has the molecular formula C24H20N2O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 3-anilino-4-phenyl-1-(2-phenylethyl)pyrrole-2,5-dione.
| Compound Name | 3-anilino-4-phenyl-1-(2-phenylethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110594191 |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-anilino-4-phenyl-1-(2-phenylethyl)pyrrole-2,5-dione |
| SMILES | O=C1C(Nc2ccccc2)=C(c2ccccc2)C(=O)N1CCc1ccccc1 |
| InChI | InChI=1S/C24H20N2O2/c27-23-21(19-12-6-2-7-13-19)22(25-20-14-8-3-9-15-20)24(28)26(23)17-16-18-10-4-1-5-11-18/h1-15,25H,16-17H2 |
| InChIKey | NFXPRWFFFFKUSI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|