C24H19FN2O4 — CID 110595308
1-(2,5-dimethoxyphenyl)-3-(3-fluoroanilino)-4-phenylpyrrole-2,5-dione (PubChem CID 110595308) has the molecular formula C24H19FN2O4 and a molecular weight of 418.42 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-3-(3-fluoroanilino)-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-dimethoxyphenyl)-3-(3-fluoroanilino)-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595308 |
| Molecular Formula | C24H19FN2O4 |
| Molecular Weight | 418.42 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-3-(3-fluoroanilino)-4-phenylpyrrole-2,5-dione |
| SMILES | COc1ccc(OC)c(N2C(=O)C(Nc3cccc(F)c3)=C(c3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C24H19FN2O4/c1-30-18-11-12-20(31-2)19(14-18)27-23(28)21(15-7-4-3-5-8-15)22(24(27)29)26-17-10-6-9-16(25)13-17/h3-14,26H,1-2H3 |
| InChIKey | RRUFLRIXPBBQHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|