C10H2F16O2 — CID 11059545
2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedial (PubChem CID 11059545) has the molecular formula C10H2F16O2 and a molecular weight of 458.09 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedial.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedial |
|---|---|
| PubChem CID | 11059545 |
| Molecular Formula | C10H2F16O2 |
| Molecular Weight | 458.09 g/mol |
| Exact Mass | 457.98 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9-hexadecafluorodecanedial |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C=O |
| InChI | InChI=1S/C10H2F16O2/c11-3(12,1-27)5(15,16)7(19,20)9(23,24)10(25,26)8(21,22)6(17,18)4(13,14)2-28/h1-2H |
| InChIKey | RNXOQXORAPANQZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.09 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|