C24H20N2O3 — CID 110595505
3-(2-ethoxyanilino)-1,4-diphenylpyrrole-2,5-dione (PubChem CID 110595505) has the molecular formula C24H20N2O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 3-(2-ethoxyanilino)-1,4-diphenylpyrrole-2,5-dione.
| Compound Name | 3-(2-ethoxyanilino)-1,4-diphenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110595505 |
| Molecular Formula | C24H20N2O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | 3-(2-ethoxyanilino)-1,4-diphenylpyrrole-2,5-dione |
| SMILES | CCOc1ccccc1NC1=C(c2ccccc2)C(=O)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C24H20N2O3/c1-2-29-20-16-10-9-15-19(20)25-22-21(17-11-5-3-6-12-17)23(27)26(24(22)28)18-13-7-4-8-14-18/h3-16,25H,2H2,1H3 |
| InChIKey | KRHFBZYKXXHVEZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|