C11H17BrHgO2 — CID 11059594
[(3aR,7aR)-4,4,7a-trimethyl-2-oxo-3a,5,6,7-tetrahydro-3H-1-benzofuran-5-yl]-bromomercury (PubChem CID 11059594) has the molecular formula C11H17BrHgO2 and a molecular weight of 461.75 g/mol. Its IUPAC name is [(3aR,7aR)-4,4,7a-trimethyl-2-oxo-3a,5,6,7-tetrahydro-3H-1-benzofuran-5-yl]-bromomercury.
| Compound Name | [(3aR,7aR)-4,4,7a-trimethyl-2-oxo-3a,5,6,7-tetrahydro-3H-1-benzofuran-5-yl]-bromomercury |
|---|---|
| PubChem CID | 11059594 |
| Molecular Formula | C11H17BrHgO2 |
| Molecular Weight | 461.75 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | [(3aR,7aR)-4,4,7a-trimethyl-2-oxo-3a,5,6,7-tetrahydro-3H-1-benzofuran-5-yl]-bromomercury |
| SMILES | CC1(C)C([Hg]Br)CC[C@@]2(C)OC(=O)C[C@H]12 |
| InChI | InChI=1S/C11H17O2.BrH.Hg/c1-10(2)5-4-6-11(3)8(10)7-9(12)13-11;;/h5,8H,4,6-7H2,1-3H3;1H;/q;;+1/p-1/t8-,11-;;/m1../s1 |
| InChIKey | SSVBLLGCDQNYED-OVYIFZAHSA-M |
| XLogP | 3.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.75 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|