C24H19F2N3O2 — CID 110596193
1-(2,5-difluorophenyl)-3-[4-(dimethylamino)anilino]-4-phenylpyrrole-2,5-dione (PubChem CID 110596193) has the molecular formula C24H19F2N3O2 and a molecular weight of 419.43 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[4-(dimethylamino)anilino]-4-phenylpyrrole-2,5-dione.
| Compound Name | 1-(2,5-difluorophenyl)-3-[4-(dimethylamino)anilino]-4-phenylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110596193 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[4-(dimethylamino)anilino]-4-phenylpyrrole-2,5-dione |
| SMILES | CN(C)c1ccc(NC2=C(c3ccccc3)C(=O)N(c3cc(F)ccc3F)C2=O)cc1 |
| InChI | InChI=1S/C24H19F2N3O2/c1-28(2)18-11-9-17(10-12-18)27-22-21(15-6-4-3-5-7-15)23(30)29(24(22)31)20-14-16(25)8-13-19(20)26/h3-14,27H,1-2H3 |
| InChIKey | CNGWNOGWUMKHBQ-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|