C26H24N4O3 — CID 110596341
N-[4-[4-(4-ethylanilino)-2,5-dioxo-1-(pyridin-4-ylmethyl)pyrrol-3-yl]phenyl]acetamide (PubChem CID 110596341) has the molecular formula C26H24N4O3 and a molecular weight of 440.50 g/mol. Its IUPAC name is N-[4-[4-(4-ethylanilino)-2,5-dioxo-1-(pyridin-4-ylmethyl)pyrrol-3-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(4-ethylanilino)-2,5-dioxo-1-(pyridin-4-ylmethyl)pyrrol-3-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 110596341 |
| Molecular Formula | C26H24N4O3 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | N-[4-[4-(4-ethylanilino)-2,5-dioxo-1-(pyridin-4-ylmethyl)pyrrol-3-yl]phenyl]acetamide |
| SMILES | CCc1ccc(NC2=C(c3ccc(NC(C)=O)cc3)C(=O)N(Cc3ccncc3)C2=O)cc1 |
| InChI | InChI=1S/C26H24N4O3/c1-3-18-4-8-22(9-5-18)29-24-23(20-6-10-21(11-7-20)28-17(2)31)25(32)30(26(24)33)16-19-12-14-27-15-13-19/h4-15,29H,3,16H2,1-2H3,(H,28,31) |
| InChIKey | UEGKEMOMOQIXSX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|