C26H27NO5S — CID 11059667
[(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(11S,15S)-8-hydroxy-16-oxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13-hexaen-9-yl]methanone (PubChem CID 11059667) has the molecular formula C26H27NO5S and a molecular weight of 465.57 g/mol. Its IUPAC name is [(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(11S,15S)-8-hydroxy-16-oxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13-hexaen-9-yl]methanone.
| Compound Name | [(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(11S,15S)-8-hydroxy-16-oxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13-hexaen-9-yl]methanone |
|---|---|
| PubChem CID | 11059667 |
| Molecular Formula | C26H27NO5S |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.16 |
| IUPAC Name | [(1S,5S,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]-[(11S,15S)-8-hydroxy-16-oxatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8,13-hexaen-9-yl]methanone |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(C(=O)c1c4c(c5ccccc5c1O)O[C@H]1C=CC[C@@H]41)[C@H]3C2 |
| InChI | InChI=1S/C26H27NO5S/c1-25(2)14-10-11-26(25)13-33(30,31)27(19(26)12-14)24(29)21-20-17-8-5-9-18(17)32-23(20)16-7-4-3-6-15(16)22(21)28/h3-7,9,14,17-19,28H,8,10-13H2,1-2H3/t14-,17-,18+,19+,26-/m1/s1 |
| InChIKey | CHVDZRRKSGYSIR-XYHCMFQOSA-N |
| XLogP | 4.33 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|