C23H27N3O4 — CID 110597139
3-(3,4-dimethoxyphenyl)-4-[4-(dimethylamino)anilino]-1-propan-2-ylpyrrole-2,5-dione (PubChem CID 110597139) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-4-[4-(dimethylamino)anilino]-1-propan-2-ylpyrrole-2,5-dione.
| Compound Name | 3-(3,4-dimethoxyphenyl)-4-[4-(dimethylamino)anilino]-1-propan-2-ylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 110597139 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-4-[4-(dimethylamino)anilino]-1-propan-2-ylpyrrole-2,5-dione |
| SMILES | COc1ccc(C2=C(Nc3ccc(N(C)C)cc3)C(=O)N(C(C)C)C2=O)cc1OC |
| InChI | InChI=1S/C23H27N3O4/c1-14(2)26-22(27)20(15-7-12-18(29-5)19(13-15)30-6)21(23(26)28)24-16-8-10-17(11-9-16)25(3)4/h7-14,24H,1-6H3 |
| InChIKey | NIODBHWMDHYCLZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|