C24H24N2O4S2 — CID 11059719
2,7-bis-(4-methylphenyl)sulfonyl-1,3,6,8-tetrahydropyrrolo[3,4-e]isoindole (PubChem CID 11059719) has the molecular formula C24H24N2O4S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is 2,7-bis-(4-methylphenyl)sulfonyl-1,3,6,8-tetrahydropyrrolo[3,4-e]isoindole.
| Compound Name | 2,7-bis-(4-methylphenyl)sulfonyl-1,3,6,8-tetrahydropyrrolo[3,4-e]isoindole |
|---|---|
| PubChem CID | 11059719 |
| Molecular Formula | C24H24N2O4S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2,7-bis-(4-methylphenyl)sulfonyl-1,3,6,8-tetrahydropyrrolo[3,4-e]isoindole |
| SMILES | Cc1ccc(S(=O)(=O)N2Cc3ccc4c(c3C2)CN(S(=O)(=O)c2ccc(C)cc2)C4)cc1 |
| InChI | InChI=1S/C24H24N2O4S2/c1-17-3-9-21(10-4-17)31(27,28)25-13-19-7-8-20-14-26(16-24(20)23(19)15-25)32(29,30)22-11-5-18(2)6-12-22/h3-12H,13-16H2,1-2H3 |
| InChIKey | XZTLGNCVNSCIPX-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |