C21H21FN2O3 — CID 110597837
3-(4-fluoroanilino)-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione (PubChem CID 110597837) has the molecular formula C21H21FN2O3 and a molecular weight of 368.41 g/mol. Its IUPAC name is 3-(4-fluoroanilino)-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-fluoroanilino)-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110597837 |
| Molecular Formula | C21H21FN2O3 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 3-(4-fluoroanilino)-4-(2-methoxyphenyl)-1-(2-methylpropyl)pyrrole-2,5-dione |
| SMILES | COc1ccccc1C1=C(Nc2ccc(F)cc2)C(=O)N(CC(C)C)C1=O |
| InChI | InChI=1S/C21H21FN2O3/c1-13(2)12-24-20(25)18(16-6-4-5-7-17(16)27-3)19(21(24)26)23-15-10-8-14(22)9-11-15/h4-11,13,23H,12H2,1-3H3 |
| InChIKey | WSZKBIOTGBEASQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|