C24H41NO5Si2 — CID 11059888
(3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione (PubChem CID 11059888) has the molecular formula C24H41NO5Si2 and a molecular weight of 479.77 g/mol. Its IUPAC name is (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione.
| Compound Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11059888 |
| Molecular Formula | C24H41NO5Si2 |
| Molecular Weight | 479.77 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | (3R,4R)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(4-methoxyphenyl)methyl]pyrrolidine-2,5-dione |
| SMILES | COc1ccc(CN2C(=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C2=O)cc1 |
| InChI | InChI=1S/C24H41NO5Si2/c1-23(2,3)31(8,9)29-19-20(30-32(10,11)24(4,5)6)22(27)25(21(19)26)16-17-12-14-18(28-7)15-13-17/h12-15,19-20H,16H2,1-11H3/t19-,20-/m1/s1 |
| InChIKey | SQWRJVPRMJNGFB-WOJBJXKFSA-N |
| XLogP | 5.34 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.77 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|