C15H20Cl3NO10 — CID 11059901
[(2R,3S,4R,5R)-3,4-diacetyloxy-6-hydroxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate (PubChem CID 11059901) has the molecular formula C15H20Cl3NO10 and a molecular weight of 480.68 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3,4-diacetyloxy-6-hydroxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-6-hydroxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 11059901 |
| Molecular Formula | C15H20Cl3NO10 |
| Molecular Weight | 480.68 g/mol |
| Exact Mass | 479.02 |
| IUPAC Name | [(2R,3S,4R,5R)-3,4-diacetyloxy-6-hydroxy-5-(2,2,2-trichloroethoxycarbonylamino)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1OC(O)[C@H](NC(=O)OCC(Cl)(Cl)Cl)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C15H20Cl3NO10/c1-6(20)25-4-9-11(27-7(2)21)12(28-8(3)22)10(13(23)29-9)19-14(24)26-5-15(16,17)18/h9-13,23H,4-5H2,1-3H3,(H,19,24)/t9-,10-,11-,12-,13?/m1/s1 |
| InChIKey | CBRVFMMFMPPAPE-JVASRFHESA-N |
| XLogP | 0.60 |
| TPSA | 146.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.68 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|