C24H20ClN3O2 — CID 110599182
3-(4-chlorophenyl)-4-(2,3-dimethylanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione (PubChem CID 110599182) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(2,3-dimethylanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(2,3-dimethylanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110599182 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(2,3-dimethylanilino)-1-(pyridin-3-ylmethyl)pyrrole-2,5-dione |
| SMILES | Cc1cccc(NC2=C(c3ccc(Cl)cc3)C(=O)N(Cc3cccnc3)C2=O)c1C |
| InChI | InChI=1S/C24H20ClN3O2/c1-15-5-3-7-20(16(15)2)27-22-21(18-8-10-19(25)11-9-18)23(29)28(24(22)30)14-17-6-4-12-26-13-17/h3-13,27H,14H2,1-2H3 |
| InChIKey | YNKPLVUHTBMEJC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|