C24H29N3O6Si — CID 11059948
2-phenyl-8-(3,4,5-trimethoxyphenyl)-6-trimethylsilyloxy-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione (PubChem CID 11059948) has the molecular formula C24H29N3O6Si and a molecular weight of 483.60 g/mol. Its IUPAC name is 2-phenyl-8-(3,4,5-trimethoxyphenyl)-6-trimethylsilyloxy-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione.
| Compound Name | 2-phenyl-8-(3,4,5-trimethoxyphenyl)-6-trimethylsilyloxy-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
|---|---|
| PubChem CID | 11059948 |
| Molecular Formula | C24H29N3O6Si |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 2-phenyl-8-(3,4,5-trimethoxyphenyl)-6-trimethylsilyloxy-5,8-dihydro-[1,2,4]triazolo[1,2-a]pyridazine-1,3-dione |
| SMILES | COc1cc(C2C=C(O[Si](C)(C)C)Cn3c(=O)n(-c4ccccc4)c(=O)n32)cc(OC)c1OC |
| InChI | InChI=1S/C24H29N3O6Si/c1-30-20-12-16(13-21(31-2)22(20)32-3)19-14-18(33-34(4,5)6)15-25-23(28)26(24(29)27(19)25)17-10-8-7-9-11-17/h7-14,19H,15H2,1-6H3 |
| InChIKey | YDCPPRJWTOMFEU-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 85.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|