C26H23ClN2O2 — CID 110599668
3-(4-chlorophenyl)-4-(3,4-dimethylanilino)-1-(3,5-dimethylphenyl)pyrrole-2,5-dione (PubChem CID 110599668) has the molecular formula C26H23ClN2O2 and a molecular weight of 430.94 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(3,4-dimethylanilino)-1-(3,5-dimethylphenyl)pyrrole-2,5-dione.
| Compound Name | 3-(4-chlorophenyl)-4-(3,4-dimethylanilino)-1-(3,5-dimethylphenyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 110599668 |
| Molecular Formula | C26H23ClN2O2 |
| Molecular Weight | 430.94 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(3,4-dimethylanilino)-1-(3,5-dimethylphenyl)pyrrole-2,5-dione |
| SMILES | Cc1cc(C)cc(N2C(=O)C(Nc3ccc(C)c(C)c3)=C(c3ccc(Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H23ClN2O2/c1-15-11-16(2)13-22(12-15)29-25(30)23(19-6-8-20(27)9-7-19)24(26(29)31)28-21-10-5-17(3)18(4)14-21/h5-14,28H,1-4H3 |
| InChIKey | BBBLVOBUJGMCPG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|