About S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride
S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride (PubChem CID 11060) has the molecular formula C20H26ClNOS
and a molecular weight of 363.95 g/mol. Its IUPAC name is S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride.
Molecular Properties
| Compound Name | S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride |
| PubChem CID | 11060 |
| Molecular Formula | C20H26ClNOS |
| Molecular Weight | 363.95 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride |
| SMILES | CCN(CC)CCSC(=O)C(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C20H25NOS.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H |
| InChIKey | MZWKCFGWAWRHDY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride?
The IUPAC name of S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride (CID 11060) is S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride.
What is the SMILES notation for S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride?
The canonical SMILES for S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride is CCN(CC)CCSC(=O)C(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride?
The InChIKey is MZWKCFGWAWRHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25NOS.ClH/c1-3-21(4-2)15-16-23-20(22)19(17-11-7-5-8-12-17)18-13-9-6-10-14-18;/h5-14,19H,3-4,15-16H2,1-2H3;1H.
What are the key properties of S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride?
S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride has a molecular weight of 363.95 g/mol, XLogP of 4.84, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-(diethylamino)ethyl] 2,2-diphenylethanethioate;hydrochloride is sourced from PubChem (CID 11060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).