C18H26Cl2N2O3 — CID 110602168
2-(2,4-dichlorophenoxy)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone (PubChem CID 110602168) has the molecular formula C18H26Cl2N2O3 and a molecular weight of 389.32 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2,4-dichlorophenoxy)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 110602168 |
| Molecular Formula | C18H26Cl2N2O3 |
| Molecular Weight | 389.32 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-1-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]ethanone |
| SMILES | COCCCN1C(C)CN(C(=O)COc2ccc(Cl)cc2Cl)CC1C |
| InChI | InChI=1S/C18H26Cl2N2O3/c1-13-10-21(11-14(2)22(13)7-4-8-24-3)18(23)12-25-17-6-5-15(19)9-16(17)20/h5-6,9,13-14H,4,7-8,10-12H2,1-3H3 |
| InChIKey | RUNYGSUVSDXSIN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|