C19H32N2O3S — CID 110602203
1-(3-methoxypropyl)-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine (PubChem CID 110602203) has the molecular formula C19H32N2O3S and a molecular weight of 368.54 g/mol. Its IUPAC name is 1-(3-methoxypropyl)-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine.
| Compound Name | 1-(3-methoxypropyl)-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 110602203 |
| Molecular Formula | C19H32N2O3S |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 1-(3-methoxypropyl)-2,6-dimethyl-4-(2,4,6-trimethylphenyl)sulfonylpiperazine |
| SMILES | COCCCN1C(C)CN(S(=O)(=O)c2c(C)cc(C)cc2C)CC1C |
| InChI | InChI=1S/C19H32N2O3S/c1-14-10-15(2)19(16(3)11-14)25(22,23)20-12-17(4)21(18(5)13-20)8-7-9-24-6/h10-11,17-18H,7-9,12-13H2,1-6H3 |
| InChIKey | XCVDEMQVMDXONQ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|