C27H36O5S2 — CID 11060226
(2S,3R,6S)-4,4-bis(benzenesulfonyl)-3-ethenyl-2-ethyl-6-hexyloxane (PubChem CID 11060226) has the molecular formula C27H36O5S2 and a molecular weight of 504.71 g/mol. Its IUPAC name is (2S,3R,6S)-4,4-bis(benzenesulfonyl)-3-ethenyl-2-ethyl-6-hexyloxane.
| Compound Name | (2S,3R,6S)-4,4-bis(benzenesulfonyl)-3-ethenyl-2-ethyl-6-hexyloxane |
|---|---|
| PubChem CID | 11060226 |
| Molecular Formula | C27H36O5S2 |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | (2S,3R,6S)-4,4-bis(benzenesulfonyl)-3-ethenyl-2-ethyl-6-hexyloxane |
| SMILES | C=C[C@@H]1[C@H](CC)O[C@@H](CCCCCC)CC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C27H36O5S2/c1-4-7-8-11-16-22-21-27(25(5-2)26(6-3)32-22,33(28,29)23-17-12-9-13-18-23)34(30,31)24-19-14-10-15-20-24/h5,9-10,12-15,17-20,22,25-26H,2,4,6-8,11,16,21H2,1,3H3/t22-,25+,26-/m0/s1 |
| InChIKey | NFNBSFZUSNTJNJ-DFCKQENNSA-N |
| XLogP | 5.97 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|