C23H25N9O3S — CID 11060260
4-(furan-2-yl)-10-[2-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine (PubChem CID 11060260) has the molecular formula C23H25N9O3S and a molecular weight of 507.58 g/mol. Its IUPAC name is 4-(furan-2-yl)-10-[2-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine.
| Compound Name | 4-(furan-2-yl)-10-[2-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
|---|---|
| PubChem CID | 11060260 |
| Molecular Formula | C23H25N9O3S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 4-(furan-2-yl)-10-[2-[4-(4-methylpiperazin-1-yl)sulfonylphenyl]ethyl]-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-7-amine |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(CCn3ncc4c3nc(N)n3nc(-c5ccco5)nc43)cc2)CC1 |
| InChI | InChI=1S/C23H25N9O3S/c1-29-10-12-30(13-11-29)36(33,34)17-6-4-16(5-7-17)8-9-31-21-18(15-25-31)22-26-20(19-3-2-14-35-19)28-32(22)23(24)27-21/h2-7,14-15H,8-13H2,1H3,(H2,24,27) |
| InChIKey | UIAWUQHFYVTKHM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 140.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |