C12H21N3O3S — CID 110603745
2-(1-butylsulfonylpiperidin-4-yl)-5-methyl-1,3,4-oxadiazole (PubChem CID 110603745) has the molecular formula C12H21N3O3S and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-(1-butylsulfonylpiperidin-4-yl)-5-methyl-1,3,4-oxadiazole.
| Compound Name | 2-(1-butylsulfonylpiperidin-4-yl)-5-methyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 110603745 |
| Molecular Formula | C12H21N3O3S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-(1-butylsulfonylpiperidin-4-yl)-5-methyl-1,3,4-oxadiazole |
| SMILES | CCCCS(=O)(=O)N1CCC(c2nnc(C)o2)CC1 |
| InChI | InChI=1S/C12H21N3O3S/c1-3-4-9-19(16,17)15-7-5-11(6-8-15)12-14-13-10(2)18-12/h11H,3-9H2,1-2H3 |
| InChIKey | DEQOATSYNXVAIU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 76.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |