C25H33IN2O2 — CID 11060381
[4-[2-(6-indol-1-ylhexoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide (PubChem CID 11060381) has the molecular formula C25H33IN2O2 and a molecular weight of 520.46 g/mol. Its IUPAC name is [4-[2-(6-indol-1-ylhexoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide.
| Compound Name | [4-[2-(6-indol-1-ylhexoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide |
|---|---|
| PubChem CID | 11060381 |
| Molecular Formula | C25H33IN2O2 |
| Molecular Weight | 520.46 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | [4-[2-(6-indol-1-ylhexoxy)-2-oxoethyl]phenyl]-trimethylazanium iodide |
| SMILES | C[N+](C)(C)c1ccc(CC(=O)OCCCCCCn2ccc3ccccc32)cc1.[I-] |
| InChI | InChI=1S/C25H33N2O2.HI/c1-27(2,3)23-14-12-21(13-15-23)20-25(28)29-19-9-5-4-8-17-26-18-16-22-10-6-7-11-24(22)26;/h6-7,10-16,18H,4-5,8-9,17,19-20H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | XVCZWLOOOQSLNE-UHFFFAOYSA-M |
| XLogP | 2.19 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|