C22H8F10O4 — CID 11060441
bis(2,3,4,5,6-pentafluorophenyl) 2,5-dimethylbenzene-1,4-dicarboxylate (PubChem CID 11060441) has the molecular formula C22H8F10O4 and a molecular weight of 526.28 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl) 2,5-dimethylbenzene-1,4-dicarboxylate.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl) 2,5-dimethylbenzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 11060441 |
| Molecular Formula | C22H8F10O4 |
| Molecular Weight | 526.28 g/mol |
| Exact Mass | 526.03 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl) 2,5-dimethylbenzene-1,4-dicarboxylate |
| SMILES | Cc1cc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)c(C)cc1C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C22H8F10O4/c1-5-3-8(22(34)36-20-17(31)13(27)10(24)14(28)18(20)32)6(2)4-7(5)21(33)35-19-15(29)11(25)9(23)12(26)16(19)30/h3-4H,1-2H3 |
| InChIKey | ALXHVWJJDUUIJJ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.28 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|