C35H36O5 — CID 11060545
(3R,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane (PubChem CID 11060545) has the molecular formula C35H36O5 and a molecular weight of 536.67 g/mol. Its IUPAC name is (3R,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane.
| Compound Name | (3R,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 11060545 |
| Molecular Formula | C35H36O5 |
| Molecular Weight | 536.67 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | (3R,4S,5R,6R)-2-methylidene-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxane |
| SMILES | C=C1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C35H36O5/c1-27-33(37-23-29-16-8-3-9-17-29)35(39-25-31-20-12-5-13-21-31)34(38-24-30-18-10-4-11-19-30)32(40-27)26-36-22-28-14-6-2-7-15-28/h2-21,32-35H,1,22-26H2/t32-,33+,34-,35-/m1/s1 |
| InChIKey | ZMPUERSSNVHHJM-AOJHZZQJSA-N |
| XLogP | 6.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.67 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |