C28H54O8Si — CID 11060650
[(4R,6R)-6-[[(4S,6S)-6-[[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol (PubChem CID 11060650) has the molecular formula C28H54O8Si and a molecular weight of 546.82 g/mol. Its IUPAC name is [(4R,6R)-6-[[(4S,6S)-6-[[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol.
| Compound Name | [(4R,6R)-6-[[(4S,6S)-6-[[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol |
|---|---|
| PubChem CID | 11060650 |
| Molecular Formula | C28H54O8Si |
| Molecular Weight | 546.82 g/mol |
| Exact Mass | 546.36 |
| IUPAC Name | [(4R,6R)-6-[[(4S,6S)-6-[[(4R,6R)-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-2,2-dimethyl-1,3-dioxan-4-yl]methanol |
| SMILES | CC1(C)O[C@H](C[C@@H]2C[C@H](CO)OC(C)(C)O2)C[C@@H](C[C@@H]2C[C@H](CO[Si](C)(C)C(C)(C)C)OC(C)(C)O2)O1 |
| InChI | InChI=1S/C28H54O8Si/c1-25(2,3)37(10,11)30-18-24-16-22(34-28(8,9)36-24)14-20-12-19(31-26(4,5)32-20)13-21-15-23(17-29)35-27(6,7)33-21/h19-24,29H,12-18H2,1-11H3/t19-,20-,21+,22+,23+,24+/m0/s1 |
| InChIKey | BXXGGDXFLQQTCZ-ZJCHSKCTSA-N |
| XLogP | 5.51 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.82 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|