C24H34INO4Si — CID 11060719
(4S)-4-benzyl-3-[(2E,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodoocta-2,7-dienoyl]-1,3-oxazolidin-2-one (PubChem CID 11060719) has the molecular formula C24H34INO4Si and a molecular weight of 555.53 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2E,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodoocta-2,7-dienoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4S)-4-benzyl-3-[(2E,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodoocta-2,7-dienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11060719 |
| Molecular Formula | C24H34INO4Si |
| Molecular Weight | 555.53 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | (4S)-4-benzyl-3-[(2E,5R,7E)-5-[tert-butyl(dimethyl)silyl]oxy-8-iodoocta-2,7-dienoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](C/C=C/I)C/C=C/C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C24H34INO4Si/c1-24(2,3)31(4,5)30-21(14-10-16-25)13-9-15-22(27)26-20(18-29-23(26)28)17-19-11-7-6-8-12-19/h6-12,15-16,20-21H,13-14,17-18H2,1-5H3/b15-9+,16-10+/t20-,21+/m0/s1 |
| InChIKey | ZUZRQTQNKWQMJS-VOEMUSBSSA-N |
| XLogP | 6.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|