About 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one
3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one (PubChem CID 110607665) has the molecular formula C23H21FN2O3
and a molecular weight of 392.43 g/mol. Its IUPAC name is 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one |
| PubChem CID | 110607665 |
| Molecular Formula | C23H21FN2O3 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one |
| SMILES | Cc1ccc(C(=O)C2CCCN2C(=O)c2cc3ccc(F)cc3[nH]c2=O)cc1C |
| InChI | InChI=1S/C23H21FN2O3/c1-13-5-6-16(10-14(13)2)21(27)20-4-3-9-26(20)23(29)18-11-15-7-8-17(24)12-19(15)25-22(18)28/h5-8,10-12,20H,3-4,9H2,1-2H3,(H,25,28) |
| InChIKey | WGLJZWZSMBMCAC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 70.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one?
The IUPAC name of 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one (CID 110607665) is 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one.
What is the SMILES notation for 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one?
The canonical SMILES for 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one is Cc1ccc(C(=O)C2CCCN2C(=O)c2cc3ccc(F)cc3[nH]c2=O)cc1C.
What is the InChIKey of 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one?
The InChIKey is WGLJZWZSMBMCAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21FN2O3/c1-13-5-6-16(10-14(13)2)21(27)20-4-3-9-26(20)23(29)18-11-15-7-8-17(24)12-19(15)25-22(18)28/h5-8,10-12,20H,3-4,9H2,1-2H3,(H,25,28).
What are the key properties of 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one?
3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one has a molecular weight of 392.43 g/mol, XLogP of 3.77, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethylbenzoyl)pyrrolidine-1-carbonyl]-7-fluoro-1H-quinolin-2-one is sourced from PubChem (CID 110607665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).