C21H29FN4O2 — CID 110608561
[1-(2-fluorophenyl)-5-methylpyrazol-3-yl]-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]methanone (PubChem CID 110608561) has the molecular formula C21H29FN4O2 and a molecular weight of 388.49 g/mol. Its IUPAC name is [1-(2-fluorophenyl)-5-methylpyrazol-3-yl]-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]methanone.
| Compound Name | [1-(2-fluorophenyl)-5-methylpyrazol-3-yl]-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 110608561 |
| Molecular Formula | C21H29FN4O2 |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | [1-(2-fluorophenyl)-5-methylpyrazol-3-yl]-[4-(3-methoxypropyl)-3,5-dimethylpiperazin-1-yl]methanone |
| SMILES | COCCCN1C(C)CN(C(=O)c2cc(C)n(-c3ccccc3F)n2)CC1C |
| InChI | InChI=1S/C21H29FN4O2/c1-15-12-19(23-26(15)20-9-6-5-8-18(20)22)21(27)24-13-16(2)25(17(3)14-24)10-7-11-28-4/h5-6,8-9,12,16-17H,7,10-11,13-14H2,1-4H3 |
| InChIKey | GPILKXQUDAQGCP-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|