C20H29FN2O2 — CID 110608652
1-[4-[3-(2-fluorophenyl)propyl]piperazin-1-yl]-2-(oxan-2-yl)ethanone (PubChem CID 110608652) has the molecular formula C20H29FN2O2 and a molecular weight of 348.46 g/mol. Its IUPAC name is 1-[4-[3-(2-fluorophenyl)propyl]piperazin-1-yl]-2-(oxan-2-yl)ethanone.
| Compound Name | 1-[4-[3-(2-fluorophenyl)propyl]piperazin-1-yl]-2-(oxan-2-yl)ethanone |
|---|---|
| PubChem CID | 110608652 |
| Molecular Formula | C20H29FN2O2 |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-[4-[3-(2-fluorophenyl)propyl]piperazin-1-yl]-2-(oxan-2-yl)ethanone |
| SMILES | O=C(CC1CCCCO1)N1CCN(CCCc2ccccc2F)CC1 |
| InChI | InChI=1S/C20H29FN2O2/c21-19-9-2-1-6-17(19)7-5-10-22-11-13-23(14-12-22)20(24)16-18-8-3-4-15-25-18/h1-2,6,9,18H,3-5,7-8,10-16H2 |
| InChIKey | KBYFJWYOFKKAAR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |