C28H57NO6Si3 — CID 11060980
1-[(2S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione (PubChem CID 11060980) has the molecular formula C28H57NO6Si3 and a molecular weight of 588.02 g/mol. Its IUPAC name is 1-[(2S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione.
| Compound Name | 1-[(2S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 11060980 |
| Molecular Formula | C28H57NO6Si3 |
| Molecular Weight | 588.02 g/mol |
| Exact Mass | 587.35 |
| IUPAC Name | 1-[(2S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-6-[[tert-butyl(dimethyl)silyl]oxymethyl]oxan-2-yl]pyrrolidine-2,5-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](N2C(=O)CCC2=O)C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H57NO6Si3/c1-26(2,3)36(10,11)32-19-21-25(35-38(14,15)28(7,8)9)20(34-37(12,13)27(4,5)6)18-24(33-21)29-22(30)16-17-23(29)31/h20-21,24-25H,16-19H2,1-15H3/t20-,21-,24+,25+/m1/s1 |
| InChIKey | DXOJKISMFODKDF-ZLSIYFNSSA-N |
| XLogP | 7.05 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.02 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|