C29H29ClF3N5O3 — CID 11060981
[4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-chloroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate (PubChem CID 11060981) has the molecular formula C29H29ClF3N5O3 and a molecular weight of 588.03 g/mol. Its IUPAC name is [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-chloroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate.
| Compound Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-chloroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11060981 |
| Molecular Formula | C29H29ClF3N5O3 |
| Molecular Weight | 588.03 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | [4-[[[1-[(3-carbamimidoylphenyl)methyl]-5-chloroindole-2-carbonyl]amino]methyl]phenyl]-trimethylazanium;2,2,2-trifluoroacetate |
| SMILES | O=C([O-])C(F)(F)F.[H]/N=C(\N)c1cccc(Cn2c(C(=O)NCc3ccc([N+](C)(C)C)cc3)cc3cc(Cl)ccc32)c1 |
| InChI | InChI=1S/C27H28ClN5O.C2HF3O2/c1-33(2,3)23-10-7-18(8-11-23)16-31-27(34)25-15-21-14-22(28)9-12-24(21)32(25)17-19-5-4-6-20(13-19)26(29)30;3-2(4,5)1(6)7/h4-15H,16-17H2,1-3H3,(H3-,29,30,31,34);(H,6,7) |
| InChIKey | PAASIFOPQISHOP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 124.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.03 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|