C28H56O4SiSn — CID 11061061
(3aR,4Z,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(tributylstannylmethylidene)-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ol (PubChem CID 11061061) has the molecular formula C28H56O4SiSn and a molecular weight of 603.55 g/mol. Its IUPAC name is (3aR,4Z,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(tributylstannylmethylidene)-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ol.
| Compound Name | (3aR,4Z,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(tributylstannylmethylidene)-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ol |
|---|---|
| PubChem CID | 11061061 |
| Molecular Formula | C28H56O4SiSn |
| Molecular Weight | 603.55 g/mol |
| Exact Mass | 604.30 |
| IUPAC Name | (3aR,4Z,5S,7S,7aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-(tributylstannylmethylidene)-5,6,7,7a-tetrahydro-3aH-1,3-benzodioxol-5-ol |
| SMILES | CCCC[Sn](/C=C1\[C@H]2OC(C)(C)O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O)(CCCC)CCCC |
| InChI | InChI=1S/C16H29O4Si.3C4H9.Sn/c1-10-11(17)9-12(20-21(7,8)15(2,3)4)14-13(10)18-16(5,6)19-14;3*1-3-4-2;/h1,11-14,17H,9H2,2-8H3;3*1,3-4H2,2H3;/t11-,12-,13+,14-;;;;/m0..../s1 |
| InChIKey | GFLHGOFSTCFXFL-OAESBECVSA-N |
| XLogP | 7.98 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.55 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|