C31H51NO9Si — CID 11061099
[(4R,5S)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate (PubChem CID 11061099) has the molecular formula C31H51NO9Si and a molecular weight of 609.83 g/mol. Its IUPAC name is [(4R,5S)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate.
| Compound Name | [(4R,5S)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
|---|---|
| PubChem CID | 11061099 |
| Molecular Formula | C31H51NO9Si |
| Molecular Weight | 609.83 g/mol |
| Exact Mass | 609.33 |
| IUPAC Name | [(4R,5S)-5-[(1R,2S)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]-2,2-dimethyl-1,3-dioxolan-4-yl]methyl benzoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H]1COC(C)(C)O1)[C@@H]1OC(C)(C)O[C@@H]1COC(=O)c1ccccc1 |
| InChI | InChI=1S/C31H51NO9Si/c1-28(2,3)40-27(34)32-23(25(22-19-36-30(7,8)37-22)41-42(11,12)29(4,5)6)24-21(38-31(9,10)39-24)18-35-26(33)20-16-14-13-15-17-20/h13-17,21-25H,18-19H2,1-12H3,(H,32,34)/t21-,22-,23-,24-,25-/m1/s1 |
| InChIKey | XXHWRDNJIKEOCS-FXEFVXDJSA-N |
| XLogP | 5.80 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.83 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|