C17H22ClNO2 — CID 110611152
1-[4-(3-chlorophenoxy)piperidin-1-yl]-2-cyclopropylpropan-1-one (PubChem CID 110611152) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is 1-[4-(3-chlorophenoxy)piperidin-1-yl]-2-cyclopropylpropan-1-one.
| Compound Name | 1-[4-(3-chlorophenoxy)piperidin-1-yl]-2-cyclopropylpropan-1-one |
|---|---|
| PubChem CID | 110611152 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 1-[4-(3-chlorophenoxy)piperidin-1-yl]-2-cyclopropylpropan-1-one |
| SMILES | CC(C(=O)N1CCC(Oc2cccc(Cl)c2)CC1)C1CC1 |
| InChI | InChI=1S/C17H22ClNO2/c1-12(13-5-6-13)17(20)19-9-7-15(8-10-19)21-16-4-2-3-14(18)11-16/h2-4,11-13,15H,5-10H2,1H3 |
| InChIKey | WCZYXONUVOYHSI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |