About N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine
N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine (PubChem CID 110611316) has the molecular formula C9H22N2O2S
and a molecular weight of 222.35 g/mol. Its IUPAC name is N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine |
| PubChem CID | 110611316 |
| Molecular Formula | C9H22N2O2S |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine |
| SMILES | CCNS(=O)(=O)NCCCC(C)(C)C |
| InChI | InChI=1S/C9H22N2O2S/c1-5-10-14(12,13)11-8-6-7-9(2,3)4/h10-11H,5-8H2,1-4H3 |
| InChIKey | RZUPTKAGTKSHHX-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine?
The IUPAC name of N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine (CID 110611316) is N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine.
What is the SMILES notation for N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine?
The canonical SMILES for N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine is CCNS(=O)(=O)NCCCC(C)(C)C.
What is the InChIKey of N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine?
The InChIKey is RZUPTKAGTKSHHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O2S/c1-5-10-14(12,13)11-8-6-7-9(2,3)4/h10-11H,5-8H2,1-4H3.
What are the key properties of N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine?
N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine has a molecular weight of 222.35 g/mol, XLogP of 1.26, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(ethylsulfamoyl)-4,4-dimethylpentan-1-amine is sourced from PubChem (CID 110611316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).