About N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine
N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine (PubChem CID 110611319) has the molecular formula C12H26N2O2S
and a molecular weight of 262.42 g/mol. Its IUPAC name is N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine.
Molecular Properties
| Compound Name | N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine |
| PubChem CID | 110611319 |
| Molecular Formula | C12H26N2O2S |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine |
| SMILES | CC(C)(C)CCCNS(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C12H26N2O2S/c1-12(2,3)9-6-10-13-17(15,16)14-11-7-4-5-8-11/h11,13-14H,4-10H2,1-3H3 |
| InChIKey | SNDCCGHSFNPBNY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine?
The IUPAC name of N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine (CID 110611319) is N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine.
What is the SMILES notation for N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine?
The canonical SMILES for N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine is CC(C)(C)CCCNS(=O)(=O)NC1CCCC1.
What is the InChIKey of N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine?
The InChIKey is SNDCCGHSFNPBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O2S/c1-12(2,3)9-6-10-13-17(15,16)14-11-7-4-5-8-11/h11,13-14H,4-10H2,1-3H3.
What are the key properties of N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine?
N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine has a molecular weight of 262.42 g/mol, XLogP of 2.18, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4,4-dimethylpentylsulfamoyl)cyclopentanamine is sourced from PubChem (CID 110611319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).