C41H58N2Si2 — CID 11061226
N,N'-bis[(1R,2R,3aS,7aR)-1-[2-[dimethyl(phenyl)silyl]ethynyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propane-1,3-diamine (PubChem CID 11061226) has the molecular formula C41H58N2Si2 and a molecular weight of 635.10 g/mol. Its IUPAC name is N,N'-bis[(1R,2R,3aS,7aR)-1-[2-[dimethyl(phenyl)silyl]ethynyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propane-1,3-diamine.
| Compound Name | N,N'-bis[(1R,2R,3aS,7aR)-1-[2-[dimethyl(phenyl)silyl]ethynyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 11061226 |
| Molecular Formula | C41H58N2Si2 |
| Molecular Weight | 635.10 g/mol |
| Exact Mass | 634.41 |
| IUPAC Name | N,N'-bis[(1R,2R,3aS,7aR)-1-[2-[dimethyl(phenyl)silyl]ethynyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-2-yl]propane-1,3-diamine |
| SMILES | C[Si](C)(C#C[C@H]1[C@@H]2CCCC[C@H]2C[C@H]1NCCCN[C@@H]1C[C@@H]2CCCC[C@H]2[C@@H]1C#C[Si](C)(C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C41H58N2Si2/c1-44(2,34-18-7-5-8-19-34)28-24-38-36-22-13-11-16-32(36)30-40(38)42-26-15-27-43-41-31-33-17-12-14-23-37(33)39(41)25-29-45(3,4)35-20-9-6-10-21-35/h5-10,18-21,32-33,36-43H,11-17,22-23,26-27,30-31H2,1-4H3/t32-,33-,36+,37+,38-,39-,40+,41+/m0/s1 |
| InChIKey | JTEATAHBAXACJP-IPFHOBHKSA-N |
| XLogP | 7.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.10 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|